CAS 38713-56-3 appears in our catalog under these names: 4-Hydroxybenzoic acid n-nonyl ester, 97%, Nonyl 4-hydroxybenzoate, 98%, Nonyl 4-hydroxybenzoate, Nonyl 4-Hydroxybenzoate, >98.0%(HPLC)(T), Nonyl 4-hydroxybenzoate, 98%(HPLC)(T). Offered by: Combi-blocks, AmBeed, Biosynth, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 50g, 500g, 250g, 250mg.
Nonyl 4-hydroxybenzoate (CAS 38713-56-3) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: nonyl 4-hydroxybenzoate. InChIKey: MBNSKHJDYXPONL-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | nonyl 4-hydroxybenzoate |
| InChIKey | MBNSKHJDYXPONL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)