CAS 32102-41-3 appears in our catalog under these names: 2,6-Di-tert-butyl-4-hydroxyphenyl acetate, 95%, 2,6–Di–tert–butyl–4–hydroxyphenyl acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2,6-ditert-butyl-4-hydroxyphenyl) acetate (CAS 32102-41-3) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: (2,6-ditert-butyl-4-hydroxyphenyl) acetate. InChIKey: SKKZEOWXZNQGGG-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | (2,6-ditert-butyl-4-hydroxyphenyl) acetate |
| InChIKey | SKKZEOWXZNQGGG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)