Products 18327-79-2
CAS 18327-79-2 appears in our catalog under these names: 2-(2,4-Di-tert-butylphenoxy)acetic acid, 97%, 2-(2,4-Di(tert-butyl)phenoxy)acetic acid, (2,4-Di-tert-butylphenoxy)acetic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 100mg, 10g, 5g, 0,5g, 1g, 250mg.
2-(2,4-ditert-butylphenoxy)acetic acid (CAS 18327-79-2) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: 2-(2,4-ditert-butylphenoxy)acetic acid. InChIKey: ZKEWJHKMOWKCFM-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | 2-(2,4-ditert-butylphenoxy)acetic acid |
| InChIKey | ZKEWJHKMOWKCFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OCC(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-(2,4-Di-tert-butylphenoxy)acetic acid, (2,4-di-tert-butylphenoxy)acetic acid, 2-(2,4-ditert-butylphenoxy)acetic Acid, Acetic acid, 2-[2,4-bis(1,1-dimethylethyl)phenoxy]-, 2-[2,4-bis(tert-butyl)phenoxy]acetic acid, Oprea1_693555, 2,4-di-t-butylphenoxyacetic acid, 2-(2,4-Di-tert-butylphenoxy)aceticacid