CAS 15872-43-2 appears in our catalog under these names: 4-(N-Nonyloxy)benzoic acid, 95%, 4-(Nonyloxy)benzoic acid, 95+%, 4-(Nonyloxy)benzoic acid, 4-(Nonyloxy)benzoic acid, 97%, 97%, 4-(Nonyloxy)benzoic acid, 97%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g.
4-nonoxybenzoic acid (CAS 15872-43-2) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: 4-nonoxybenzoic acid. InChIKey: BOZLUAUKDKKZHJ-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | 4-nonoxybenzoic acid |
| InChIKey | BOZLUAUKDKKZHJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)