CAS 111540-00-2 appears in our catalog under these names: Ochromycinone, Ochromycinone/ 97.48% (existing batch purity), Ochromycinone (STA-21), Ochromycinone 98%, 8-Hydroxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 250mg.
8-hydroxy-3-methyl-3,4-dihydro-2H-benzo[a]anthracene-1,7,12-trione (CAS 111540-00-2) is a chemical compound with the molecular formula C19H14O4 and a molecular weight of 306.3 g/mol. IUPAC name: 8-hydroxy-3-methyl-3,4-dihydro-2H-benzo[a]anthracene-1,7,12-trione. InChIKey: ZAWXOCUFQSQDJS-UHFFFAOYSA-N.
| Molecular formula | C19H14O4 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 8-hydroxy-3-methyl-3,4-dihydro-2H-benzo[a]anthracene-1,7,12-trione |
| InChIKey | ZAWXOCUFQSQDJS-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=O)C1)C3=C(C=C2)C(=O)C4=C(C3=O)C=CC=C4O |
Computed by PubChem (NCBI)