cas: 1364932-19-3 — see every product listed under this CAS number, including other names
Oseltamivir impurity A, 95% (CAS 1364932-19-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A635322-1mg |
| cas | 1364932-19-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 720.81 Pln | |
| Ambeed | 5mg | 1538.50 Pln | |
| Ambeed | 10mg | 2272.75 Pln | |
| Ambeed | 25mg | 4253.00 Pln | |
| Ambeed | 50mg | 7184.44 Pln | |
| Ambeed | 100mg | 12174.00 Pln | |
| Ambeed | 250mg | 24272.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 1364932-19-3) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: (3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: MKPOADZCFCZMRW-YNEHKIRRSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | MKPOADZCFCZMRW-YNEHKIRRSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)