CAS 1391047-93-0 is the registry number for 4-N-Desacetyl-5-N-acetyl Oseltamivir Acid. Offered by: TRC. Available pack sizes: 25mg.
(3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 1391047-93-0) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: (3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: MKPOADZCFCZMRW-YNEHKIRRSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | MKPOADZCFCZMRW-YNEHKIRRSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)