CAS 1364932-19-3 appears in our catalog under these names: (3R,4R,5S)-5-Acetamido-4-amino-3-(pentan-3-yloxy)cyclohex-1-enecarboxylic acid, 95%, Oseltamivir Phosphate EP Impurity A, Oseltamivir Impurity 1(Oseltamivir EP Impurity A), (3R,4R,5S)-5-(Acetylamino)-4-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylic acid, Oseltamivir impurity A. Offered by: Fluorochem, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 1364932-19-3) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: (3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: MKPOADZCFCZMRW-YNEHKIRRSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (3R,4R,5S)-5-acetamido-4-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | MKPOADZCFCZMRW-YNEHKIRRSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1N)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)