Oxanilide, 98%, 98%
cas: 620-81-5 — see every product listed under this CAS number, including other names
Oxanilide, 98%, 98% (CAS 620-81-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAYG-1g |
| cas | 620-81-5 |
| size | 1g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 746.00 Pln | |
| Chemat | 500g | 2817.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N'-diphenyloxamide (CAS 620-81-5) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: N,N'-diphenyloxamide. InChIKey: FTWUXYZHDFCGSV-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | N,N'-diphenyloxamide |
| InChIKey | FTWUXYZHDFCGSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)