cas: 120-55-8 — see every product listed under this CAS number, including other names
Oxybis(ethane-2,1-diyl) dibenzoate, 90%, 90% (CAS 120-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111Q1Q-1kg |
| cas | 120-55-8 |
| size | 1kg |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 467.60 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 500g | 273.60 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
2-(2-benzoyloxyethoxy)ethyl benzoate (CAS 120-55-8) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 2-(2-benzoyloxyethoxy)ethyl benzoate. InChIKey: NXQMCAOPTPLPRL-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2-(2-benzoyloxyethoxy)ethyl benzoate |
| InChIKey | NXQMCAOPTPLPRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCOCCOC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)