CAS 56558-16-8 appears in our catalog under these names: PCB No. 104, 2,2',4,6,6'–Pentachlorobiphenyl, 2,2',4,6,6'-Pentachlorobiphenyl, PCB 104, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, HPC Standards. Available pack sizes: 5mg, 1ml, 10mg, 25mg, 50mg, 1x5ml.
1,3,5-trichloro-2-(2,6-dichlorophenyl)benzene (CAS 56558-16-8) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,3,5-trichloro-2-(2,6-dichlorophenyl)benzene. InChIKey: MTCPZNVSDFCBBE-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,3,5-trichloro-2-(2,6-dichlorophenyl)benzene |
| InChIKey | MTCPZNVSDFCBBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=C(C=C(C=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)