CAS 74472-35-8 appears in our catalog under these names: 2,3,3',4,6-Pentachlorobiphenyl, PCB 109, ROTI®Star, 5 mg, glass, PCB 109, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Biosynth, Roth, HPC Standards. Available pack sizes: 25ml, 50ml, 5mg, 1x5ml.
1,2,3,5-tetrachloro-4-(3-chlorophenyl)benzene (CAS 74472-35-8) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3,5-tetrachloro-4-(3-chlorophenyl)benzene. InChIKey: XGQBSVVYMVILEL-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3,5-tetrachloro-4-(3-chlorophenyl)benzene |
| InChIKey | XGQBSVVYMVILEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=C(C(=C(C=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)