Products 1219799-24-2
CAS 1219799-24-2 appears in our catalog under these names: 2,3,4,4',5-Pentachlorobiphenyl-2',3',5',6'-d4, >95% (HPLC), 2,3,4,4',5-Pentachlorobiphenyl-2',3',5',6'-d4, 98 atom % D, min 98% Chemical Purity, 2,3,4,4',5–Pentachloro–1,1'–biphenyl–d4, 2,3,4,4',5-Pentachloro-1,1'-biphenyl-d4. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
1-chloro-2,3,5,6-tetradeuterio-4-(2,3,4,5-tetrachlorophenyl)benzene (CAS 1219799-24-2) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 330.4 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-(2,3,4,5-tetrachlorophenyl)benzene. InChIKey: SXZSFWHOSHAKMN-RHQRLBAQSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-chloro-2,3,5,6-tetradeuterio-4-(2,3,4,5-tetrachlorophenyl)benzene |
| InChIKey | SXZSFWHOSHAKMN-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=CC(=C(C(=C2Cl)Cl)Cl)Cl)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)