Products 38444-73-4
CAS 38444-73-4 appears in our catalog under these names: PCB No. 19, 2,2',6-Trichlorobiphenyl, PCB 19, ROTI®Star, 10 mg, glass, PCB 19, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Dr. Ehrenstorfer, Biosynth, Roth, HPC Standards. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 1x5ml.
1,3-dichloro-2-(2-chlorophenyl)benzene (CAS 38444-73-4) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 1,3-dichloro-2-(2-chlorophenyl)benzene. InChIKey: MVXIJRBBCDLNLX-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 1,3-dichloro-2-(2-chlorophenyl)benzene |
| InChIKey | MVXIJRBBCDLNLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=CC=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)