CAS 74472-36-9 appears in our catalog under these names: PCB No. 112, PCB No. 112 10 µg/mL in Isooctane, 2,3,3',5,6–Pentachlorobiphenyl, 2,3,3',5,6-Pentachlorobiphenyl, PCB 112, ROTI®Star, 5 mg, glass. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, Roth, HPC Standards. Available pack sizes: 5mg, 10ml, 1ml, 25ml, 50ml, 1x5ml.
1,2,4,5-tetrachloro-3-(3-chlorophenyl)benzene (CAS 74472-36-9) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3-(3-chlorophenyl)benzene. InChIKey: NTKSJAPQYKCFPP-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3-(3-chlorophenyl)benzene |
| InChIKey | NTKSJAPQYKCFPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)