CAS 56558-18-0 appears in our catalog under these names: PCB No. 121, PCB No. 121 10 µg/mL in Isooctane, 2,3',4,5',6-Pentachlorobiphenyl, PCB 121, ROTI®Star, 5 mg, glass, PCB 121, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Dr. Ehrenstorfer, Biosynth, Roth, HPC Standards. Available pack sizes: 5mg, 10ml, 25mg, 10mg, 50mg, 1x5ml.
1,3,5-trichloro-2-(3,5-dichlorophenyl)benzene (CAS 56558-18-0) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,3,5-trichloro-2-(3,5-dichlorophenyl)benzene. InChIKey: XBVSGJGMWSKAKL-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,3,5-trichloro-2-(3,5-dichlorophenyl)benzene |
| InChIKey | XBVSGJGMWSKAKL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)