CAS 38380-02-8 appears in our catalog under these names: PCB No. 87, PCB No. 87 10 µg/mL in Isooctane, PCB 87, ROTI®Star, 10 mg, glass, PCB 87, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: Dr. Ehrenstorfer, Roth, HPC Standards. Available pack sizes: 10mg, 10ml, 1x5ml.
1,2,3-trichloro-4-(2,5-dichlorophenyl)benzene (CAS 38380-02-8) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3-trichloro-4-(2,5-dichlorophenyl)benzene. InChIKey: OPKYDBFRKPQCBS-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(2,5-dichlorophenyl)benzene |
| InChIKey | OPKYDBFRKPQCBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=C(C(=C(C=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)