CAS 88742-93-2 appears in our catalog under these names: 5-(1-Phenylcyclopropyl)-1,3,4-thiadiazol-2-amine, 5-(1-Phenylcyclopropyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-(1-phenylcyclopropyl)-1,3,4-thiadiazol-2-amine (CAS 88742-93-2) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 5-(1-phenylcyclopropyl)-1,3,4-thiadiazol-2-amine. InChIKey: XGCRKKXNDQBJGR-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 5-(1-phenylcyclopropyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | XGCRKKXNDQBJGR-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)