CAS 923193-02-6 is the registry number for 3-Cyclopropyl-1-phenyl-1H-1,2,4-triazole-5-thiol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-cyclopropyl-2-phenyl-1H-1,2,4-triazole-3-thione (CAS 923193-02-6) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 5-cyclopropyl-2-phenyl-1H-1,2,4-triazole-3-thione. InChIKey: HQFPFIJRKXJFRK-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 5-cyclopropyl-2-phenyl-1H-1,2,4-triazole-3-thione |
| InChIKey | HQFPFIJRKXJFRK-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=S)N(N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)