CAS 220095-93-2 is the registry number for PD-1/PD-L1-IN-29 intermediate-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl (2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate (CAS 220095-93-2) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: tert-butyl (2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: KEGGPKIRWQIHQT-GFCCVEGCSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | tert-butyl (2R)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | KEGGPKIRWQIHQT-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CO)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)