cas: 4382-63-2 — see every product listed under this CAS number, including other names
PFK-015 99% (HPLC) (CAS 4382-63-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131123-1mg |
| cas | 4382-63-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 142.31 Pln | |
| Ambeed | 5mg | 209.06 Pln | |
| Ambeed | 10mg | 264.69 Pln | |
| Ambeed | 50mg | 587.31 Pln | |
| Ambeed | 100mg | 948.88 Pln | |
| Ambeed | 250mg | 1566.31 Pln | |
| Ambeed | 1g | 4086.12 Pln |
| purity | 99% (HPLC) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131123 |
(E)-1-pyridin-4-yl-3-quinolin-2-ylprop-2-en-1-one (CAS 4382-63-2) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: (E)-1-pyridin-4-yl-3-quinolin-2-ylprop-2-en-1-one. InChIKey: UJJUKZPBUMCSJZ-BQYQJAHWSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (E)-1-pyridin-4-yl-3-quinolin-2-ylprop-2-en-1-one |
| InChIKey | UJJUKZPBUMCSJZ-BQYQJAHWSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)/C=C/C(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)