Products 1073542-96-7
CAS 1073542-96-7 is the registry number for 3-(9H-Pyrido(3,4-b)indol-1-yl)phenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
3-(9H-pyrido[3,4-b]indol-1-yl)phenol (CAS 1073542-96-7) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 3-(9H-pyrido[3,4-b]indol-1-yl)phenol. InChIKey: FECICFUYGJYTCL-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 3-(9H-pyrido[3,4-b]indol-1-yl)phenol |
| InChIKey | FECICFUYGJYTCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CC(=CC=C4)O |
Computed by PubChem (NCBI)