CAS 114648-67-8 is the registry number for (1H-Indol-2-yl)(1H-indol-3-yl)methanone, 95+%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.
1H-indol-2-yl(1H-indol-3-yl)methanone (CAS 114648-67-8) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 1H-indol-2-yl(1H-indol-3-yl)methanone. InChIKey: ZYCSHQBGKAGFMY-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 1H-indol-2-yl(1H-indol-3-yl)methanone |
| InChIKey | ZYCSHQBGKAGFMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)