CAS 95888-12-3 appears in our catalog under these names: 2-Naphthalen-2-yl-benzooxazol-5-yl-amine, 95%, 2-Naphthalen-2-ylbenzooxazol-5-ylamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
2-naphthalen-2-yl-1,3-benzoxazol-5-amine (CAS 95888-12-3) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 2-naphthalen-2-yl-1,3-benzoxazol-5-amine. InChIKey: YUVSHBCMUZGXKP-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 2-naphthalen-2-yl-1,3-benzoxazol-5-amine |
| InChIKey | YUVSHBCMUZGXKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC4=C(O3)C=CC(=C4)N |
Computed by PubChem (NCBI)