CAS 73053-83-5 is the registry number for 5-(1H-Indol-3-yl)-2-phenyloxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1H-indol-3-yl)-2-phenyl-1,3-oxazole (CAS 73053-83-5) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 5-(1H-indol-3-yl)-2-phenyl-1,3-oxazole. InChIKey: HTCJVEQRKUDXFH-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 5-(1H-indol-3-yl)-2-phenyl-1,3-oxazole |
| InChIKey | HTCJVEQRKUDXFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(O2)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)