Products 1214344-98-5
CAS 1214344-98-5 appears in our catalog under these names: 2,5-Di(pyridin-4-yl)benzaldehyde, 98%, 2,5–Di(pyridin–4–yl)benzaldehyde, 2,5-Di(pyridin-4-yl)benzaldehyde, 95%, 95%. Offered by: Fluorochem, GLPBio, Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2,5-dipyridin-4-ylbenzaldehyde (CAS 1214344-98-5) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 2,5-dipyridin-4-ylbenzaldehyde. InChIKey: UGVILPKAAXAGON-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 2,5-dipyridin-4-ylbenzaldehyde |
| InChIKey | UGVILPKAAXAGON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=NC=C2)C=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)