cas: 25800-31-1 — see every product listed under this CAS number, including other names
PROPYL 2,4-DICHLOROBENZOATE, 97% (CAS 25800-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844304-100MG |
| cas | 25800-31-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 1g | 2106.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Propyl 2,4-dichlorobenzoate (CAS 25800-31-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: propyl 2,4-dichlorobenzoate. InChIKey: ZOIIQQAHABCSLU-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | propyl 2,4-dichlorobenzoate |
| InChIKey | ZOIIQQAHABCSLU-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)