CAS 1823212-44-7 is the registry number for 3'-Dichloromethyl-4'-methoxyacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-[3-(dichloromethyl)-4-methoxyphenyl]ethanone (CAS 1823212-44-7) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 1-[3-(dichloromethyl)-4-methoxyphenyl]ethanone. InChIKey: ITZIVVGLRLOEDD-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 1-[3-(dichloromethyl)-4-methoxyphenyl]ethanone |
| InChIKey | ITZIVVGLRLOEDD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)C(Cl)Cl |
Computed by PubChem (NCBI)