Products 1803844-86-1

CAS 1803844-86-1 is the registry number for Ethyl 2,3-dichloro-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,3-dichloro-4-methylbenzoate (CAS 1803844-86-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 2,3-dichloro-4-methylbenzoate. InChIKey: OEFGTASSMLTKGV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10Cl2O2
Molecular weight233.09 g/mol
IUPAC nameethyl 2,3-dichloro-4-methylbenzoate
InChIKeyOEFGTASSMLTKGV-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=C(C=C1)C)Cl)Cl

Computed by PubChem (NCBI)