CAS 1803844-86-1 is the registry number for Ethyl 2,3-dichloro-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2,3-dichloro-4-methylbenzoate (CAS 1803844-86-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 2,3-dichloro-4-methylbenzoate. InChIKey: OEFGTASSMLTKGV-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | ethyl 2,3-dichloro-4-methylbenzoate |
| InChIKey | OEFGTASSMLTKGV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)C)Cl)Cl |
Computed by PubChem (NCBI)