cas: 165904-22-3 — see every product listed under this CAS number, including other names
Phenethylboronic Acid Pinacol Ester 98% (CAS 165904-22-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A316032-1g |
| cas | 165904-22-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A316032 |
4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane (CAS 165904-22-3) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane. InChIKey: LVLQNRWCBBIVHR-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane |
| InChIKey | LVLQNRWCBBIVHR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2=CC=CC=C2 |
Computed by PubChem (NCBI)