CAS 81267-65-4 appears in our catalog under these names: Phenoxodiol/ 98.07% (existing batch purity), Dehydroequol, Dehydroequol, 97.00%, Phenoxodiol 98%, Phenoxodiol, 99.89%. Offered by: TargetMol, Biosynth, Chemat, Ambeed, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
3-(4-hydroxyphenyl)-2H-chromen-7-ol (CAS 81267-65-4) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-2H-chromen-7-ol. InChIKey: ZZUBHVMHNVYXRR-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-2H-chromen-7-ol |
| InChIKey | ZZUBHVMHNVYXRR-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C=C(C=C2)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)