cas: 487-24-1 — see every product listed under this CAS number, including other names
Pratol (CAS 487-24-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 5mg, 500mg, 1000mg, 2000mg, 5000mg, 1mg, 25mg. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress.
| brand | GLPBio |
|---|---|
| catalog number | GC72067-10 |
| cas | 487-24-1 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 957.44 Pln | |
| GLPBio | 5mg | 756.18 Pln | |
| Biosynth | 500mg | price on request | |
| Biosynth | 1000mg | price on request | |
| Biosynth | 2000mg | price on request | |
| Biosynth | 5000mg | price on request | |
| Chemat | 1mg | 578.00 Pln | |
| Chemat | 5mg | 1518.80 Pln | |
| Chemat | 10mg | 2325.20 Pln | |
| Chemat | 25mg | 4024.40 Pln | |
| MedChemExpress | 10 mg | 1007.00 Pln | |
| MedChemExpress | 5 mg | 677.28 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
7-hydroxy-2-(4-methoxyphenyl)chromen-4-one (CAS 487-24-1) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 7-hydroxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: SQVXWIUVAILQRH-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 7-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | SQVXWIUVAILQRH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)O |
Computed by PubChem (NCBI)