cas: 6165-75-9 — see every product listed under this CAS number, including other names
Prop-2-yn-1-yl benzenesulfonate, 97%, 97% (CAS 6165-75-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TYZ-5g |
| cas | 6165-75-9 |
| size | 5g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 174.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Prop-2-ynyl benzenesulfonate (CAS 6165-75-9) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: prop-2-ynyl benzenesulfonate. InChIKey: RAGBYXLIHQFIPK-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | prop-2-ynyl benzenesulfonate |
| InChIKey | RAGBYXLIHQFIPK-UHFFFAOYSA-N |
| SMILES | C#CCOS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)