cas: 119793-66-7 — see every product listed under this CAS number, including other names
Propionyl-L-carnitine HCl, 98% (CAS 119793-66-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137851-1mg |
| cas | 119793-66-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 125.62 Pln | |
| Ambeed | 10mg | 136.75 Pln | |
| Ambeed | 50mg | 153.44 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 387.06 Pln | |
| Ambeed | 100g | 759.75 Pln | |
| Ambeed | 500g | 2478.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[(2R)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium chloride (CAS 119793-66-7) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 253.72 g/mol. IUPAC name: [(2R)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium chloride. InChIKey: KTFMPDDJYRFWQE-DDWIOCJRSA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium chloride |
| InChIKey | KTFMPDDJYRFWQE-DDWIOCJRSA-N |
| SMILES | CCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)