Products 16948-36-0
CAS 16948-36-0 appears in our catalog under these names: (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate hydrochloride, 97%, H-D-Glu(OtBu)-OMe·HCl 97%, H-D-Glu(OtBu)-OMe.HCl, 97%, 97%, h-d-glu(otbu)-ome.hcl, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride (CAS 16948-36-0) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 253.72 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: YIFPACFSZQWAQF-OGFXRTJISA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | YIFPACFSZQWAQF-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
h-d-Glu(OtBu)-OMe.HCl, (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate hydrochloride, 5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride, D-Glutamic acid alpha-methyl-ester-delta-t-butyl ester hydrochloride, 5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate, D-glutamic acid gamma-tert.butylester alpha-methyl este, H-D-Glu(OtBu)-OMe inverted exclamation mark currencyHCl, d-glutamic acid 5-tert-butyl 1-methyl, 5-(tert-butyl) 1-methyl D-glutamate hydrochloride, D-Glutamic acid 5-tert-butyl 1-methyl ester hydrochloride