CAS 16948-36-0 appears in our catalog under these names: (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate hydrochloride, 97%, H-D-Glu(OtBu)-OMe.HCl, 97%, 97%, h-d-glu(otbu)-ome.hcl, 97%, H-D-Glu(OtBu)-OMe·HCl, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride (CAS 16948-36-0) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 253.72 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: YIFPACFSZQWAQF-OGFXRTJISA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | YIFPACFSZQWAQF-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)