Products 119793-66-7
CAS 119793-66-7 appears in our catalog under these names: (R)-Propionyl Carnitine Chloride, >95% (HPLC), Levocarnitine propionate hydrochloride/ 98%, Levocarnitine propionate hydrochloride (L–Propionylcarnitine chloride), Propionyl-L-carnitine Hydrochloride, >98.0%(T), (R)-Propionyl carnitine chloride, 98.00%. Offered by: TRC, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 25mg, 10mg, 50mg, 200mg, 500mg, 1g, 250mg.
[(2R)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium chloride (CAS 119793-66-7) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 253.72 g/mol. IUPAC name: [(2R)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium chloride. InChIKey: KTFMPDDJYRFWQE-DDWIOCJRSA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium chloride |
| InChIKey | KTFMPDDJYRFWQE-DDWIOCJRSA-N |
| SMILES | CCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Levocarnitine propionate hydrochloride, Dromos, Levocarnitine propionate HCl, Dromos (TN), Propionyl L-carnitine hydrochloride, Levocarnitine propionate hydrochloride [USAN], Levocarnitine propionate hydrochloride (USAN), (2R)-3-Carboxy-N,N,N-trimethyl-2-(propanoyloxy)propan-1-aminium chloride, 1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-(1-oxopropoxy)-, chloride, (R)-, LEVOCARNITINE PROPIONATE HYDROCHLORIDE (MART.)