Products 1334532-19-2
CAS 1334532-19-2 appears in our catalog under these names: (R)-Propionyl Carnitine-d3 Chloride, >95% (HPLC), Propionyl-L-carnitine-d3 HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Propionyl–L–carnitine–d3 (chloride), Levocarnitine propionate-d3 (hydrochloride), 98.89%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,05g, 0,01g, 1mg, 5mg, 5 mg, 1 mg.
[(2R)-3-carboxy-2-propanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (CAS 1334532-19-2) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 256.74 g/mol. IUPAC name: [(2R)-3-carboxy-2-propanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride. InChIKey: KTFMPDDJYRFWQE-WVKKGGDISA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 256.74 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-propanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| InChIKey | KTFMPDDJYRFWQE-WVKKGGDISA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CC.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
(R)-Propionyl Carnitine-d3 Chloride, Levocarnitine propionate-d3 (hydrochloride), Propionyl-L-carnitine-d3 HCl (N-methyl-d3), Propionyl-L-carnitine-d3 (chloride), [(2R)-3-carboxy-2-(propanoyloxy)propyl]((?H?)methyl)dimethylazanium chloride, Propionyl-L-carnitine-d3 HCl, Propionyl-L-carnitine-d3 chloride, Propionyl-L-carnitine-(N-methyl-d3) hydrochloride, 99 atom % D, 98% (CP)