CAS 53665-67-1 appears in our catalog under these names: (S)-4-tert-Butyl 1-ethyl 2-aminosuccinate hydroChloride, 98%, Aspartic acid, 4-tert-butyl 1-ethyl ester, hydrochloride, 95%, 95%, 4-TERT-BUTYL 1-ETHYL (2S)-2-AMINOBUTANEDIOATE HYDROCHLORIDE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-O-tert-butyl 1-O-ethyl (2S)-2-aminobutanedioate;hydrochloride (CAS 53665-67-1) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 253.72 g/mol. IUPAC name: 4-O-tert-butyl 1-O-ethyl (2S)-2-aminobutanedioate;hydrochloride. InChIKey: DUSZYZCRZKWPGQ-FJXQXJEOSA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-ethyl (2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | DUSZYZCRZKWPGQ-FJXQXJEOSA-N |
| SMILES | CCOC(=O)[C@H](CC(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)