CAS 6234-01-1 appears in our catalog under these names: L-Glutamic Acid 5-tert-Butyl 1-Methyl Ester Hydrochloride, H–Glu(OtBu)–OMe·HCl, H-L-Glu(OtBu)-OMe*HCl, L-Glutamic acid 5-tert-butyl 1-methyl ester hydrochloride, 9, 5-tert-Butyl 1-Methyl L-Glutamate Hydrochloride, >98.0%(N)(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 2,5g, 25g, 10g, 5g, 100g, 10 g, 5 g.
5-O-tert-butyl 1-O-methyl (2S)-2-aminopentanedioate;hydrochloride (CAS 6234-01-1) is a chemical compound with the molecular formula C10H20ClNO4 and a molecular weight of 253.72 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (2S)-2-aminopentanedioate;hydrochloride. InChIKey: YIFPACFSZQWAQF-FJXQXJEOSA-N.
| Molecular formula | C10H20ClNO4 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (2S)-2-aminopentanedioate;hydrochloride |
| InChIKey | YIFPACFSZQWAQF-FJXQXJEOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)