Pseudothymidine, 99.44%, 99.44%
cas: 65358-15-8 — see every product listed under this CAS number, including other names
Pseudothymidine, 99.44%, 99.44% (CAS 65358-15-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBCB-1mg |
| cas | 65358-15-8 |
| size | 1mg |
| availability | 0.01g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 1869.20 Pln | |
| Chemat | 5mg | 5435.60 Pln | |
| Chemat | 10mg | 8632.40 Pln |
properties
| purity | 99.44% |
|---|---|
| delivery time | 3 weeks |
5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione (CAS 65358-15-8) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione. InChIKey: AMDJRICBYOAHBZ-XLPZGREQSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione |
| InChIKey | AMDJRICBYOAHBZ-XLPZGREQSA-N |
| SMILES | CN1C=C(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)