cas: 24057-28-1 — see every product listed under this CAS number, including other names
Pyridin-1-ium 4-methylbenzenesulfonate 98% (CAS 24057-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122417-1g |
| cas | 24057-28-1 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 264.69 Pln | |
| Ambeed | 500g | 453.81 Pln | |
| Ambeed | 1000g | 826.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122417 |
4-methylbenzenesulfonate;pyridin-1-ium (CAS 24057-28-1) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: 4-methylbenzenesulfonate;pyridin-1-ium. InChIKey: ZDYVRSLAEXCVBX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;pyridin-1-ium |
| InChIKey | ZDYVRSLAEXCVBX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C1=CC=[NH+]C=C1 |
Computed by PubChem (NCBI)