cas: 24057-28-1 — see every product listed under this CAS number, including other names
Pyridinium p-toluenesulfonate, 95% (CAS 24057-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044338-1KG |
| cas | 24057-28-1 |
| size | 1kg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1kg | 679.99 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 237.43 Pln | |
| Fluorochem | 250g | 310.33 Pln | |
| Fluorochem | 500g | 367.60 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| transportryczalt.1 | 50 |
| category | Odczynniki chemiczne |
4-methylbenzenesulfonate;pyridin-1-ium (CAS 24057-28-1) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: 4-methylbenzenesulfonate;pyridin-1-ium. InChIKey: ZDYVRSLAEXCVBX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;pyridin-1-ium |
| InChIKey | ZDYVRSLAEXCVBX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C1=CC=[NH+]C=C1 |
Computed by PubChem (NCBI)