cas: 443692-93-1 — see every product listed under this CAS number, including other names
QUINOLINE-7-SULFONYL CHLORIDE, 95% (CAS 443692-93-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F388332-250MG |
| cas | 443692-93-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1138.16 Pln | |
| Fluorochem | 500mg | 2096.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Quinoline-7-sulfonyl chloride (CAS 443692-93-1) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: quinoline-7-sulfonyl chloride. InChIKey: ZSLBTAMFISNVKS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | quinoline-7-sulfonyl chloride |
| InChIKey | ZSLBTAMFISNVKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)S(=O)(=O)Cl)N=C1 |
Computed by PubChem (NCBI)