cas: 745784-12-7 — see every product listed under this CAS number, including other names
Quinolin-2-ylboronic acid, 95%, 95% (CAS 745784-12-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114U4H-100mg |
| cas | 745784-12-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 2013.20 Pln | |
| Chemat | 5g | 6558.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Quinolin-2-ylboronic acid (CAS 745784-12-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-2-ylboronic acid. InChIKey: DWHCQRBWSBKHMI-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-2-ylboronic acid |
| InChIKey | DWHCQRBWSBKHMI-UHFFFAOYSA-N |
| SMILES | B(C1=NC2=CC=CC=C2C=C1)(O)O |
Computed by PubChem (NCBI)