cas: 18004-62-1 — see every product listed under this CAS number, including other names
Quinolin-2-ylmethanamine dihydrochloride, 97%, 97% (CAS 18004-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132NH-100mg |
| cas | 18004-62-1 |
| size | 100mg |
| availability | 9.41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 602.00 Pln | |
| Chemat | 5g | 2426.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Quinolin-2-ylmethanamine;dihydrochloride (CAS 18004-62-1) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: quinolin-2-ylmethanamine;dihydrochloride. InChIKey: XPAZBFLKFMBGMF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | quinolin-2-ylmethanamine;dihydrochloride |
| InChIKey | XPAZBFLKFMBGMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)