cas: 930570-40-4 — see every product listed under this CAS number, including other names
Quinoline, 6-bromo-4-chloro-2-ethyl-, >95%, >95% (CAS 930570-40-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHGQ-250mg |
| cas | 930570-40-4 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1144.40 Pln | |
| Chemat | 1g | 2114.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-4-chloro-2-ethylquinoline (CAS 930570-40-4) is a chemical compound with the molecular formula C11H9BrClN and a molecular weight of 270.55 g/mol. IUPAC name: 6-bromo-4-chloro-2-ethylquinoline. InChIKey: BTDUERYMNJZNRZ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClN |
|---|---|
| Molecular weight | 270.55 g/mol |
| IUPAC name | 6-bromo-4-chloro-2-ethylquinoline |
| InChIKey | BTDUERYMNJZNRZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C2C=C(C=CC2=N1)Br)Cl |
Computed by PubChem (NCBI)