CAS 1367706-81-7 is the registry number for 7-Bromo-2-chloro-4,8-dimethylquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7-bromo-2-chloro-4,8-dimethylquinoline (CAS 1367706-81-7) is a chemical compound with the molecular formula C11H9BrClN and a molecular weight of 270.55 g/mol. IUPAC name: 7-bromo-2-chloro-4,8-dimethylquinoline. InChIKey: YNKWPNWNLZEXCH-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClN |
|---|---|
| Molecular weight | 270.55 g/mol |
| IUPAC name | 7-bromo-2-chloro-4,8-dimethylquinoline |
| InChIKey | YNKWPNWNLZEXCH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC(=C2C)Br)Cl |
Computed by PubChem (NCBI)