CAS 1070879-69-4 is the registry number for 4-Bromo-7-chloro-2,8-dimethylquinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-bromo-7-chloro-2,8-dimethylquinoline (CAS 1070879-69-4) is a chemical compound with the molecular formula C11H9BrClN and a molecular weight of 270.55 g/mol. IUPAC name: 4-bromo-7-chloro-2,8-dimethylquinoline. InChIKey: ITXAGISRCZQTMO-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClN |
|---|---|
| Molecular weight | 270.55 g/mol |
| IUPAC name | 4-bromo-7-chloro-2,8-dimethylquinoline |
| InChIKey | ITXAGISRCZQTMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=C(C2=N1)C)Cl)Br |
Computed by PubChem (NCBI)