CAS 1153002-90-4 appears in our catalog under these names: 6-Bromo-4-chloro-2,8-dimethylquinoline, 6-Bromo-4-chloro-2,8-dimethylquinoline, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g, 5g.
6-bromo-4-chloro-2,8-dimethylquinoline (CAS 1153002-90-4) is a chemical compound with the molecular formula C11H9BrClN and a molecular weight of 270.55 g/mol. IUPAC name: 6-bromo-4-chloro-2,8-dimethylquinoline. InChIKey: YJTIVPXNBMXIJP-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClN |
|---|---|
| Molecular weight | 270.55 g/mol |
| IUPAC name | 6-bromo-4-chloro-2,8-dimethylquinoline |
| InChIKey | YJTIVPXNBMXIJP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C(C=C(N=C12)C)Cl)Br |
Computed by PubChem (NCBI)