CAS 1156275-57-8 appears in our catalog under these names: 8-Bromo-4-chloro-2,6-dimethylquinoline, 95%, 8-Bromo-4-chloro-2,6-dimethylquinoline, 97%, 8-Bromo-4-chloro-2,6-dimethylquinoline, 99%, 99%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
8-bromo-4-chloro-2,6-dimethylquinoline (CAS 1156275-57-8) is a chemical compound with the molecular formula C11H9BrClN and a molecular weight of 270.55 g/mol. IUPAC name: 8-bromo-4-chloro-2,6-dimethylquinoline. InChIKey: XKEXCBVAJCIAMY-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClN |
|---|---|
| Molecular weight | 270.55 g/mol |
| IUPAC name | 8-bromo-4-chloro-2,6-dimethylquinoline |
| InChIKey | XKEXCBVAJCIAMY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(N=C2C(=C1)Br)C)Cl |
Computed by PubChem (NCBI)